C17H22N4O — CID 4120557
1,3-bis(2-pyridin-4-ylpropan-2-yl)urea (PubChem CID 4120557) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 1,3-bis(2-pyridin-4-ylpropan-2-yl)urea.
| Compound Name | 1,3-bis(2-pyridin-4-ylpropan-2-yl)urea |
|---|---|
| PubChem CID | 4120557 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1,3-bis(2-pyridin-4-ylpropan-2-yl)urea |
| SMILES | CC(C)(NC(=O)NC(C)(C)c1ccncc1)c1ccncc1 |
| InChI | InChI=1S/C17H22N4O/c1-16(2,13-5-9-18-10-6-13)20-15(22)21-17(3,4)14-7-11-19-12-8-14/h5-12H,1-4H3,(H2,20,21,22) |
| InChIKey | MPQNTBWFKWKXON-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |