C13H18N4O2S — CID 4120710
5-butylsulfanyl-1,3,7-trimethylpyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 4120710) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 5-butylsulfanyl-1,3,7-trimethylpyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 5-butylsulfanyl-1,3,7-trimethylpyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4120710 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-butylsulfanyl-1,3,7-trimethylpyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | CCCCSc1nc(C)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C13H18N4O2S/c1-5-6-7-20-11-9-10(14-8(2)15-11)16(3)13(19)17(4)12(9)18/h5-7H2,1-4H3 |
| InChIKey | VPDUZOZFKJUGFG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|