About methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate
methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate (PubChem CID 4121127) has the molecular formula C17H21N3O6S
and a molecular weight of 395.44 g/mol. Its IUPAC name is methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate.
Molecular Properties
| Compound Name | methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate |
| PubChem CID | 4121127 |
| Molecular Formula | C17H21N3O6S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate |
| SMILES | COC(=O)CN(c1ccc(C(C)C)cc1)S(=O)(=O)c1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H21N3O6S/c1-10(2)12-5-7-13(8-6-12)20(9-14(21)26-4)27(24,25)15-11(3)18-17(23)19-16(15)22/h5-8,10H,9H2,1-4H3,(H2,18,19,22,23) |
| InChIKey | XMYVIEOBSCJAPM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 129.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate?
The IUPAC name of methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate (CID 4121127) is methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate.
What is the SMILES notation for methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate?
The canonical SMILES for methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate is COC(=O)CN(c1ccc(C(C)C)cc1)S(=O)(=O)c1c(C)[nH]c(=O)[nH]c1=O.
What is the InChIKey of methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate?
The InChIKey is XMYVIEOBSCJAPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O6S/c1-10(2)12-5-7-13(8-6-12)20(9-14(21)26-4)27(24,25)15-11(3)18-17(23)19-16(15)22/h5-8,10H,9H2,1-4H3,(H2,18,19,22,23).
What are the key properties of methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate?
methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate has a molecular weight of 395.44 g/mol, XLogP of 0.86, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[N-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-4-propan-2-ylanilino]acetate is sourced from PubChem (CID 4121127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).