C17H16IN3OS2 — CID 41213688
N-(2-iodophenyl)-2-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide (PubChem CID 41213688) has the molecular formula C17H16IN3OS2 and a molecular weight of 469.37 g/mol. Its IUPAC name is N-(2-iodophenyl)-2-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide.
| Compound Name | N-(2-iodophenyl)-2-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 41213688 |
| Molecular Formula | C17H16IN3OS2 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.98 |
| IUPAC Name | N-(2-iodophenyl)-2-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide |
| SMILES | Cc1nc(SCC(=O)Nc2ccccc2I)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C17H16IN3OS2/c1-9-10(2)24-17-15(9)16(19-11(3)20-17)23-8-14(22)21-13-7-5-4-6-12(13)18/h4-7H,8H2,1-3H3,(H,21,22) |
| InChIKey | VAIDNMIAMUELHD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|