C23H23N5 — CID 4121418
1-(2,4-dimethylphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 4121418) has the molecular formula C23H23N5 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-(2,4-dimethylphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 4121418 |
| Molecular Formula | C23H23N5 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(-n2ncc3c(Nc4cccc5c4CCCC5)ncnc32)c(C)c1 |
| InChI | InChI=1S/C23H23N5/c1-15-10-11-21(16(2)12-15)28-23-19(13-26-28)22(24-14-25-23)27-20-9-5-7-17-6-3-4-8-18(17)20/h5,7,9-14H,3-4,6,8H2,1-2H3,(H,24,25,27) |
| InChIKey | GMAVHQPATHZEHA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |