About 3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione
3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione (PubChem CID 4121712) has the molecular formula C23H31Cl2N3O3
and a molecular weight of 468.43 g/mol. Its IUPAC name is 3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione |
| PubChem CID | 4121712 |
| Molecular Formula | C23H31Cl2N3O3 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione |
| SMILES | CCCCCCCCn1c(O)c(/C=N/c2cc(Cl)ccc2Cl)c(=O)n(CCCC)c1=O |
| InChI | InChI=1S/C23H31Cl2N3O3/c1-3-5-7-8-9-10-14-28-22(30)18(21(29)27(23(28)31)13-6-4-2)16-26-20-15-17(24)11-12-19(20)25/h11-12,15-16,30H,3-10,13-14H2,1-2H3/b26-16+ |
| InChIKey | VQTIUITUXIGZLH-WGOQTCKBSA-N |
| XLogP | 5.93 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione?
The IUPAC name of 3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione (CID 4121712) is 3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione.
What is the SMILES notation for 3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione?
The canonical SMILES for 3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione is CCCCCCCCn1c(O)c(/C=N/c2cc(Cl)ccc2Cl)c(=O)n(CCCC)c1=O.
What is the InChIKey of 3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione?
The InChIKey is VQTIUITUXIGZLH-WGOQTCKBSA-N. The full InChI is InChI=1S/C23H31Cl2N3O3/c1-3-5-7-8-9-10-14-28-22(30)18(21(29)27(23(28)31)13-6-4-2)16-26-20-15-17(24)11-12-19(20)25/h11-12,15-16,30H,3-10,13-14H2,1-2H3/b26-16+.
What are the key properties of 3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione?
3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione has a molecular weight of 468.43 g/mol, XLogP of 5.93, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-5-[(2,5-dichlorophenyl)iminomethyl]-6-hydroxy-1-octylpyrimidine-2,4-dione is sourced from PubChem (CID 4121712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).