About 6,7-dimethoxyquinazoline-2,4-diamine
6,7-dimethoxyquinazoline-2,4-diamine (PubChem CID 4122435) has the molecular formula C10H12N4O2
and a molecular weight of 220.23 g/mol. Its IUPAC name is 6,7-dimethoxyquinazoline-2,4-diamine.
Molecular Properties
| Compound Name | 6,7-dimethoxyquinazoline-2,4-diamine |
| PubChem CID | 4122435 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 6,7-dimethoxyquinazoline-2,4-diamine |
| SMILES | COc1cc2nc(N)nc(N)c2cc1OC |
| InChI | InChI=1S/C10H12N4O2/c1-15-7-3-5-6(4-8(7)16-2)13-10(12)14-9(5)11/h3-4H,1-2H3,(H4,11,12,13,14) |
| InChIKey | ZCIPYVXKMWNKLZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6,7-dimethoxyquinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxyquinazoline-2,4-diamine?
The IUPAC name of 6,7-dimethoxyquinazoline-2,4-diamine (CID 4122435) is 6,7-dimethoxyquinazoline-2,4-diamine.
What is the SMILES notation for 6,7-dimethoxyquinazoline-2,4-diamine?
The canonical SMILES for 6,7-dimethoxyquinazoline-2,4-diamine is COc1cc2nc(N)nc(N)c2cc1OC.
What is the InChIKey of 6,7-dimethoxyquinazoline-2,4-diamine?
The InChIKey is ZCIPYVXKMWNKLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O2/c1-15-7-3-5-6(4-8(7)16-2)13-10(12)14-9(5)11/h3-4H,1-2H3,(H4,11,12,13,14).
What are the key properties of 6,7-dimethoxyquinazoline-2,4-diamine?
6,7-dimethoxyquinazoline-2,4-diamine has a molecular weight of 220.23 g/mol, XLogP of 0.81, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxyquinazoline-2,4-diamine is sourced from PubChem (CID 4122435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).