C34H48N2O6 — CID 4122591
4-[(4-butoxyphenyl)-hydroxymethylidene]-1-[3-(diethylamino)propyl]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 4122591) has the molecular formula C34H48N2O6 and a molecular weight of 580.77 g/mol. Its IUPAC name is 4-[(4-butoxyphenyl)-hydroxymethylidene]-1-[3-(diethylamino)propyl]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(4-butoxyphenyl)-hydroxymethylidene]-1-[3-(diethylamino)propyl]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4122591 |
| Molecular Formula | C34H48N2O6 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | 4-[(4-butoxyphenyl)-hydroxymethylidene]-1-[3-(diethylamino)propyl]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(C2C(=C(O)c3ccc(OCCCC)cc3)C(=O)C(=O)N2CCCN(CC)CC)cc1OC |
| InChI | InChI=1S/C34H48N2O6/c1-6-10-12-23-42-28-19-16-26(24-29(28)40-5)31-30(32(37)25-14-17-27(18-15-25)41-22-11-7-2)33(38)34(39)36(31)21-13-20-35(8-3)9-4/h14-19,24,31,37H,6-13,20-23H2,1-5H3 |
| InChIKey | GEEVRRBBZVVRAC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|