C17H22FNO3 — CID 4123166
(2-fluorophenyl) 5-(cyclohexylamino)-5-oxopentanoate (PubChem CID 4123166) has the molecular formula C17H22FNO3 and a molecular weight of 307.36 g/mol. Its IUPAC name is (2-fluorophenyl) 5-(cyclohexylamino)-5-oxopentanoate.
| Compound Name | (2-fluorophenyl) 5-(cyclohexylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 4123166 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (2-fluorophenyl) 5-(cyclohexylamino)-5-oxopentanoate |
| SMILES | O=C(CCCC(=O)Oc1ccccc1F)NC1CCCCC1 |
| InChI | InChI=1S/C17H22FNO3/c18-14-9-4-5-10-15(14)22-17(21)12-6-11-16(20)19-13-7-2-1-3-8-13/h4-5,9-10,13H,1-3,6-8,11-12H2,(H,19,20) |
| InChIKey | HOVQQLMISGFCAZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|