C25H21ClN2O — CID 41235791
(3R)-2-[2-(4-chlorophenyl)ethyl]-3-(2-methyl-1H-indol-3-yl)-3H-isoindol-1-one (PubChem CID 41235791) has the molecular formula C25H21ClN2O and a molecular weight of 400.91 g/mol. Its IUPAC name is (3R)-2-[2-(4-chlorophenyl)ethyl]-3-(2-methyl-1H-indol-3-yl)-3H-isoindol-1-one.
| Compound Name | (3R)-2-[2-(4-chlorophenyl)ethyl]-3-(2-methyl-1H-indol-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 41235791 |
| Molecular Formula | C25H21ClN2O |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (3R)-2-[2-(4-chlorophenyl)ethyl]-3-(2-methyl-1H-indol-3-yl)-3H-isoindol-1-one |
| SMILES | Cc1[nH]c2ccccc2c1[C@H]1c2ccccc2C(=O)N1CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H21ClN2O/c1-16-23(21-8-4-5-9-22(21)27-16)24-19-6-2-3-7-20(19)25(29)28(24)15-14-17-10-12-18(26)13-11-17/h2-13,24,27H,14-15H2,1H3/t24-/m1/s1 |
| InChIKey | SAUXVURRSIYLGJ-XMMPIXPASA-N |
| XLogP | 5.92 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|