C14H11N3OS — CID 4123610
3-benzyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 4123610) has the molecular formula C14H11N3OS and a molecular weight of 269.33 g/mol. Its IUPAC name is 3-benzyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 3-benzyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4123610 |
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 3-benzyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2cccnc2[nH]c(=S)n1Cc1ccccc1 |
| InChI | InChI=1S/C14H11N3OS/c18-13-11-7-4-8-15-12(11)16-14(19)17(13)9-10-5-2-1-3-6-10/h1-8H,9H2,(H,15,16,19) |
| InChIKey | FEDNXGYKZBQYBN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|