C18H25N3O5 — CID 41236732
methyl (2R)-2-[(3,5-diacetamidobenzoyl)amino]-4-methylpentanoate (PubChem CID 41236732) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is methyl (2R)-2-[(3,5-diacetamidobenzoyl)amino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[(3,5-diacetamidobenzoyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 41236732 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | methyl (2R)-2-[(3,5-diacetamidobenzoyl)amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)c1cc(NC(C)=O)cc(NC(C)=O)c1 |
| InChI | InChI=1S/C18H25N3O5/c1-10(2)6-16(18(25)26-5)21-17(24)13-7-14(19-11(3)22)9-15(8-13)20-12(4)23/h7-10,16H,6H2,1-5H3,(H,19,22)(H,20,23)(H,21,24)/t16-/m1/s1 |
| InChIKey | LKCISTTZIQSKJU-MRXNPFEDSA-N |
| XLogP | 1.92 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |