About 1-(3,4-dimethylphenyl)pyrrole
1-(3,4-dimethylphenyl)pyrrole (PubChem CID 4123753) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)pyrrole.
Molecular Properties
| Compound Name | 1-(3,4-dimethylphenyl)pyrrole |
| PubChem CID | 4123753 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 1-(3,4-dimethylphenyl)pyrrole |
| SMILES | Cc1ccc(-n2cccc2)cc1C |
| InChI | InChI=1S/C12H13N/c1-10-5-6-12(9-11(10)2)13-7-3-4-8-13/h3-9H,1-2H3 |
| InChIKey | VCLKRNGEWADHGI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,4-dimethylphenyl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethylphenyl)pyrrole?
The IUPAC name of 1-(3,4-dimethylphenyl)pyrrole (CID 4123753) is 1-(3,4-dimethylphenyl)pyrrole.
What is the SMILES notation for 1-(3,4-dimethylphenyl)pyrrole?
The canonical SMILES for 1-(3,4-dimethylphenyl)pyrrole is Cc1ccc(-n2cccc2)cc1C.
What is the InChIKey of 1-(3,4-dimethylphenyl)pyrrole?
The InChIKey is VCLKRNGEWADHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N/c1-10-5-6-12(9-11(10)2)13-7-3-4-8-13/h3-9H,1-2H3.
What are the key properties of 1-(3,4-dimethylphenyl)pyrrole?
1-(3,4-dimethylphenyl)pyrrole has a molecular weight of 171.24 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethylphenyl)pyrrole is sourced from PubChem (CID 4123753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).