C25H18ClNO3 — CID 4123755
2-[2-[(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)oxy]ethyl]isoindole-1,3-dione (PubChem CID 4123755) has the molecular formula C25H18ClNO3 and a molecular weight of 415.88 g/mol. Its IUPAC name is 2-[2-[(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)oxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)oxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4123755 |
| Molecular Formula | C25H18ClNO3 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-[2-[(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)oxy]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCOC1c2ccccc2C=Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H18ClNO3/c26-18-12-11-17-10-9-16-5-1-2-6-19(16)23(22(17)15-18)30-14-13-27-24(28)20-7-3-4-8-21(20)25(27)29/h1-12,15,23H,13-14H2 |
| InChIKey | HBETWXHJNBRIRB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|