C23H19N5O5 — CID 41240408
2-[3-[(4-methylphenyl)methyl]-2,4-dioxopyrido[3,2-d]pyrimidin-1-yl]-N-(3-nitrophenyl)acetamide (PubChem CID 41240408) has the molecular formula C23H19N5O5 and a molecular weight of 445.44 g/mol. Its IUPAC name is 2-[3-[(4-methylphenyl)methyl]-2,4-dioxopyrido[3,2-d]pyrimidin-1-yl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[3-[(4-methylphenyl)methyl]-2,4-dioxopyrido[3,2-d]pyrimidin-1-yl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 41240408 |
| Molecular Formula | C23H19N5O5 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-[3-[(4-methylphenyl)methyl]-2,4-dioxopyrido[3,2-d]pyrimidin-1-yl]-N-(3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(Cn2c(=O)c3ncccc3n(CC(=O)Nc3cccc([N+](=O)[O-])c3)c2=O)cc1 |
| InChI | InChI=1S/C23H19N5O5/c1-15-7-9-16(10-8-15)13-27-22(30)21-19(6-3-11-24-21)26(23(27)31)14-20(29)25-17-4-2-5-18(12-17)28(32)33/h2-12H,13-14H2,1H3,(H,25,29) |
| InChIKey | XHGMHFASWHEJFB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|