C21H19ClN4O6 — CID 41241068
N-[2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]ethyl]-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 41241068) has the molecular formula C21H19ClN4O6 and a molecular weight of 458.86 g/mol. Its IUPAC name is N-[2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]ethyl]-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-[2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]ethyl]-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 41241068 |
| Molecular Formula | C21H19ClN4O6 |
| Molecular Weight | 458.86 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | N-[2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]ethyl]-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCCn2nc(-c3ccc(Cl)cc3)ccc2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H19ClN4O6/c1-31-18-11-15(17(26(29)30)12-19(18)32-2)21(28)23-9-10-25-20(27)8-7-16(24-25)13-3-5-14(22)6-4-13/h3-8,11-12H,9-10H2,1-2H3,(H,23,28) |
| InChIKey | BQFUZPWROZUWMX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|