C23H18N8O3 — CID 41241902
4-methyl-N-[5-methyl-2-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]-3-nitrobenzamide (PubChem CID 41241902) has the molecular formula C23H18N8O3 and a molecular weight of 454.45 g/mol. Its IUPAC name is 4-methyl-N-[5-methyl-2-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]-3-nitrobenzamide.
| Compound Name | 4-methyl-N-[5-methyl-2-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 41241902 |
| Molecular Formula | C23H18N8O3 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 4-methyl-N-[5-methyl-2-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]-3-nitrobenzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(C)c([N+](=O)[O-])c2)n(-c2ncnc3c2cnn3-c2ccccc2)n1 |
| InChI | InChI=1S/C23H18N8O3/c1-14-8-9-16(11-19(14)31(33)34)23(32)27-20-10-15(2)28-30(20)22-18-12-26-29(21(18)24-13-25-22)17-6-4-3-5-7-17/h3-13H,1-2H3,(H,27,32) |
| InChIKey | ARAHUQOXDHWHMD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|