C28H27N3O4 — CID 41242699
(3R)-3-[4-(4-benzoylphenyl)piperazin-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 41242699) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is (3R)-3-[4-(4-benzoylphenyl)piperazin-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(4-benzoylphenyl)piperazin-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 41242699 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (3R)-3-[4-(4-benzoylphenyl)piperazin-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C[C@@H](N3CCN(c4ccc(C(=O)c5ccccc5)cc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C28H27N3O4/c1-35-24-13-11-23(12-14-24)31-26(32)19-25(28(31)34)30-17-15-29(16-18-30)22-9-7-21(8-10-22)27(33)20-5-3-2-4-6-20/h2-14,25H,15-19H2,1H3/t25-/m1/s1 |
| InChIKey | IYYGCJNNZKXOOE-RUZDIDTESA-N |
| XLogP | 3.38 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|