C17H10Cl3N3O3 — CID 4124584
6-hydroxy-1-phenyl-5-[(2,4,6-trichlorophenyl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 4124584) has the molecular formula C17H10Cl3N3O3 and a molecular weight of 410.64 g/mol. Its IUPAC name is 6-hydroxy-1-phenyl-5-[(2,4,6-trichlorophenyl)iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-phenyl-5-[(2,4,6-trichlorophenyl)iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4124584 |
| Molecular Formula | C17H10Cl3N3O3 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | 6-hydroxy-1-phenyl-5-[(2,4,6-trichlorophenyl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2)c(O)c1/C=N/c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C17H10Cl3N3O3/c18-9-6-12(19)14(13(20)7-9)21-8-11-15(24)22-17(26)23(16(11)25)10-4-2-1-3-5-10/h1-8,25H,(H,22,24,26)/b21-8+ |
| InChIKey | UKFMDFOBSYVNHT-ODCIPOBUSA-N |
| XLogP | 3.94 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|