C18H14ClN3O2 — CID 41247714
1-[(4-chlorophenyl)methyl]-6-oxo-N-phenylpyridazine-3-carboxamide (PubChem CID 41247714) has the molecular formula C18H14ClN3O2 and a molecular weight of 339.78 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-6-oxo-N-phenylpyridazine-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-6-oxo-N-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 41247714 |
| Molecular Formula | C18H14ClN3O2 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-6-oxo-N-phenylpyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(=O)n(Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C18H14ClN3O2/c19-14-8-6-13(7-9-14)12-22-17(23)11-10-16(21-22)18(24)20-15-4-2-1-3-5-15/h1-11H,12H2,(H,20,24) |
| InChIKey | QTSWTVLXTPLYTG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |