C17H15ClN4O4S — CID 41251966
N-[(2-chloro-5-nitrophenyl)methyl]-N-methyl-3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide (PubChem CID 41251966) has the molecular formula C17H15ClN4O4S and a molecular weight of 406.85 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methyl]-N-methyl-3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methyl]-N-methyl-3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide |
|---|---|
| PubChem CID | 41251966 |
| Molecular Formula | C17H15ClN4O4S |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methyl]-N-methyl-3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide |
| SMILES | CN(Cc1cc([N+](=O)[O-])ccc1Cl)C(=O)CCn1cnc2sccc2c1=O |
| InChI | InChI=1S/C17H15ClN4O4S/c1-20(9-11-8-12(22(25)26)2-3-14(11)18)15(23)4-6-21-10-19-16-13(17(21)24)5-7-27-16/h2-3,5,7-8,10H,4,6,9H2,1H3 |
| InChIKey | QKUNGXLKWSKBNA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|