C12H16ClF6NO — CID 4125332
4-chloro-N-cyclooctyl-2,2,3,3,4,4-hexafluorobutanamide (PubChem CID 4125332) has the molecular formula C12H16ClF6NO and a molecular weight of 339.71 g/mol. Its IUPAC name is 4-chloro-N-cyclooctyl-2,2,3,3,4,4-hexafluorobutanamide.
| Compound Name | 4-chloro-N-cyclooctyl-2,2,3,3,4,4-hexafluorobutanamide |
|---|---|
| PubChem CID | 4125332 |
| Molecular Formula | C12H16ClF6NO |
| Molecular Weight | 339.71 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-chloro-N-cyclooctyl-2,2,3,3,4,4-hexafluorobutanamide |
| SMILES | O=C(NC1CCCCCCC1)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C12H16ClF6NO/c13-12(18,19)11(16,17)10(14,15)9(21)20-8-6-4-2-1-3-5-7-8/h8H,1-7H2,(H,20,21) |
| InChIKey | SMIRPESRYMMNKP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.71 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|