About N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine
N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine (PubChem CID 4125591) has the molecular formula C9H13N5OS
and a molecular weight of 239.30 g/mol. Its IUPAC name is N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine |
| PubChem CID | 4125591 |
| Molecular Formula | C9H13N5OS |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine |
| SMILES | Nc1cc(N)nc(SC2CCCC2=NO)n1 |
| InChI | InChI=1S/C9H13N5OS/c10-7-4-8(11)13-9(12-7)16-6-3-1-2-5(6)14-15/h4,6,15H,1-3H2,(H4,10,11,12,13) |
| InChIKey | ZIABSKNETZLNPT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine?
The IUPAC name of N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine (CID 4125591) is N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine.
What is the SMILES notation for N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine?
The canonical SMILES for N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine is Nc1cc(N)nc(SC2CCCC2=NO)n1.
What is the InChIKey of N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine?
The InChIKey is ZIABSKNETZLNPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5OS/c10-7-4-8(11)13-9(12-7)16-6-3-1-2-5(6)14-15/h4,6,15H,1-3H2,(H4,10,11,12,13).
What are the key properties of N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine?
N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine has a molecular weight of 239.30 g/mol, XLogP of 1.12, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,6-diaminopyrimidin-2-yl)sulfanylcyclopentylidene]hydroxylamine is sourced from PubChem (CID 4125591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).