C25H31N3OS — CID 4125675
2-(3-cyanospiro[1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-4,1'-cyclohexane]-2-yl)sulfanyl-N-(2-methylphenyl)acetamide (PubChem CID 4125675) has the molecular formula C25H31N3OS and a molecular weight of 421.61 g/mol. Its IUPAC name is 2-(3-cyanospiro[1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-4,1'-cyclohexane]-2-yl)sulfanyl-N-(2-methylphenyl)acetamide.
| Compound Name | 2-(3-cyanospiro[1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-4,1'-cyclohexane]-2-yl)sulfanyl-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4125675 |
| Molecular Formula | C25H31N3OS |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 2-(3-cyanospiro[1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-4,1'-cyclohexane]-2-yl)sulfanyl-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)CSC1=C(C#N)C2(CCCCC2)C2=C(CCCCC2)N1 |
| InChI | InChI=1S/C25H31N3OS/c1-18-10-6-7-12-21(18)27-23(29)17-30-24-20(16-26)25(14-8-3-9-15-25)19-11-4-2-5-13-22(19)28-24/h6-7,10,12,28H,2-5,8-9,11,13-15,17H2,1H3,(H,27,29) |
| InChIKey | WJACKONNIDQBKU-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |