C24H26N2O3S — CID 41257208
N-[(6-methoxynaphthalen-2-yl)methyl]-2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzamide (PubChem CID 41257208) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-[(6-methoxynaphthalen-2-yl)methyl]-2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzamide.
| Compound Name | N-[(6-methoxynaphthalen-2-yl)methyl]-2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 41257208 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-[(6-methoxynaphthalen-2-yl)methyl]-2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzamide |
| SMILES | COc1ccc2cc(CNC(=O)c3ccccc3SCC(=O)NC(C)C)ccc2c1 |
| InChI | InChI=1S/C24H26N2O3S/c1-16(2)26-23(27)15-30-22-7-5-4-6-21(22)24(28)25-14-17-8-9-19-13-20(29-3)11-10-18(19)12-17/h4-13,16H,14-15H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | MSSAHDXGPMLKNB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |