C10H21NO2 — CID 4125777
1-hydroxy-4-methoxy-2,2,6,6-tetramethylpiperidine (PubChem CID 4125777) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 1-hydroxy-4-methoxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-hydroxy-4-methoxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 4125777 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 1-hydroxy-4-methoxy-2,2,6,6-tetramethylpiperidine |
| SMILES | COC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C10H21NO2/c1-9(2)6-8(13-5)7-10(3,4)11(9)12/h8,12H,6-7H2,1-5H3 |
| InChIKey | KRNWYBIEWUXCOB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |