C26H10F22N4O2 — CID 4125852
1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[4-phenyldiazenyl-3-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]phenyl]cyclohexane-1-carboxamide (PubChem CID 4125852) has the molecular formula C26H10F22N4O2 and a molecular weight of 828.35 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[4-phenyldiazenyl-3-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]phenyl]cyclohexane-1-carboxamide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[4-phenyldiazenyl-3-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 4125852 |
| Molecular Formula | C26H10F22N4O2 |
| Molecular Weight | 828.35 g/mol |
| Exact Mass | 828.05 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[4-phenyldiazenyl-3-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]phenyl]cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccc(/N=N\c2ccccc2)c(NC(=O)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)c1)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C26H10F22N4O2/c27-15(17(29,30)21(37,38)25(45,46)22(39,40)18(15,31)32)13(53)49-10-6-7-11(52-51-9-4-2-1-3-5-9)12(8-10)50-14(54)16(28)19(33,34)23(41,42)26(47,48)24(43,44)20(16,35)36/h1-8H,(H,49,53)(H,50,54)/b52-51- |
| InChIKey | XPTHOPARKYGZDB-LLSHYXBFSA-N |
| XLogP | 9.78 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.35 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|