C25H30N4O3S2 — CID 41259499
2-[[2-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]acetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 41259499) has the molecular formula C25H30N4O3S2 and a molecular weight of 498.67 g/mol. Its IUPAC name is 2-[[2-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]acetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]acetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 41259499 |
| Molecular Formula | C25H30N4O3S2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 2-[[2-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]acetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COCCNC(=O)c1c(NC(=O)CN2CCC[C@@H]2c2nc3ccccc3s2)sc2c1CCCC2 |
| InChI | InChI=1S/C25H30N4O3S2/c1-32-14-12-26-23(31)22-16-7-2-4-10-19(16)33-25(22)28-21(30)15-29-13-6-9-18(29)24-27-17-8-3-5-11-20(17)34-24/h3,5,8,11,18H,2,4,6-7,9-10,12-15H2,1H3,(H,26,31)(H,28,30)/t18-/m1/s1 |
| InChIKey | ROLUJTNZXAUPTE-GOSISDBHSA-N |
| XLogP | 4.39 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|