C17H23ClN2O5S — CID 41259616
(2R,3R)-2-[(4-chloro-3-pyrrolidin-1-ylsulfonylbenzoyl)amino]-3-methylpentanoic acid (PubChem CID 41259616) has the molecular formula C17H23ClN2O5S and a molecular weight of 402.90 g/mol. Its IUPAC name is (2R,3R)-2-[(4-chloro-3-pyrrolidin-1-ylsulfonylbenzoyl)amino]-3-methylpentanoic acid.
| Compound Name | (2R,3R)-2-[(4-chloro-3-pyrrolidin-1-ylsulfonylbenzoyl)amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 41259616 |
| Molecular Formula | C17H23ClN2O5S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (2R,3R)-2-[(4-chloro-3-pyrrolidin-1-ylsulfonylbenzoyl)amino]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1)C(=O)O |
| InChI | InChI=1S/C17H23ClN2O5S/c1-3-11(2)15(17(22)23)19-16(21)12-6-7-13(18)14(10-12)26(24,25)20-8-4-5-9-20/h6-7,10-11,15H,3-5,8-9H2,1-2H3,(H,19,21)(H,22,23)/t11-,15-/m1/s1 |
| InChIKey | FHUOIRKDJNZVMW-IAQYHMDHSA-N |
| XLogP | 2.35 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |