C23H22N2O4 — CID 41264139
N'-[2-(5-acetyl-2-methoxyphenyl)acetyl]-2-naphthalen-1-ylacetohydrazide (PubChem CID 41264139) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N'-[2-(5-acetyl-2-methoxyphenyl)acetyl]-2-naphthalen-1-ylacetohydrazide.
| Compound Name | N'-[2-(5-acetyl-2-methoxyphenyl)acetyl]-2-naphthalen-1-ylacetohydrazide |
|---|---|
| PubChem CID | 41264139 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N'-[2-(5-acetyl-2-methoxyphenyl)acetyl]-2-naphthalen-1-ylacetohydrazide |
| SMILES | COc1ccc(C(C)=O)cc1CC(=O)NNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C23H22N2O4/c1-15(26)17-10-11-21(29-2)19(12-17)14-23(28)25-24-22(27)13-18-8-5-7-16-6-3-4-9-20(16)18/h3-12H,13-14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | ZGLYYTIUXLOIHW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|