C21H24N2O2 — CID 41264652
3,5-dimethyl-N-[2-oxo-2-[(2R)-2-phenylpyrrolidin-1-yl]ethyl]benzamide (PubChem CID 41264652) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-oxo-2-[(2R)-2-phenylpyrrolidin-1-yl]ethyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[2-oxo-2-[(2R)-2-phenylpyrrolidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 41264652 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3,5-dimethyl-N-[2-oxo-2-[(2R)-2-phenylpyrrolidin-1-yl]ethyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCC(=O)N2CCC[C@@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-15-11-16(2)13-18(12-15)21(25)22-14-20(24)23-10-6-9-19(23)17-7-4-3-5-8-17/h3-5,7-8,11-13,19H,6,9-10,14H2,1-2H3,(H,22,25)/t19-/m1/s1 |
| InChIKey | VSEODWINFMGKLI-LJQANCHMSA-N |
| XLogP | 3.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |