C25H33N3O5S — CID 4126760
N-(1,3-benzodioxol-5-ylmethyl)-2-[butylcarbamoyl(oxolan-2-ylmethyl)amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 4126760) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[butylcarbamoyl(oxolan-2-ylmethyl)amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[butylcarbamoyl(oxolan-2-ylmethyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4126760 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[butylcarbamoyl(oxolan-2-ylmethyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCCCNC(=O)N(CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1cccs1)CC1CCCO1 |
| InChI | InChI=1S/C25H33N3O5S/c1-2-3-10-26-25(30)28(15-20-6-4-11-31-20)17-24(29)27(16-21-7-5-12-34-21)14-19-8-9-22-23(13-19)33-18-32-22/h5,7-9,12-13,20H,2-4,6,10-11,14-18H2,1H3,(H,26,30) |
| InChIKey | QKMNCTWPKWUUFT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|