C23H26ClN3O2S2 — CID 41272482
4-(4-chlorophenyl)sulfanyl-1-[4-(6-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]butan-1-one (PubChem CID 41272482) has the molecular formula C23H26ClN3O2S2 and a molecular weight of 476.07 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-1-[4-(6-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-1-[4-(6-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 41272482 |
| Molecular Formula | C23H26ClN3O2S2 |
| Molecular Weight | 476.07 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-1-[4-(6-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]butan-1-one |
| SMILES | CCOc1ccc2nc(N3CCN(C(=O)CCCSc4ccc(Cl)cc4)CC3)sc2c1 |
| InChI | InChI=1S/C23H26ClN3O2S2/c1-2-29-18-7-10-20-21(16-18)31-23(25-20)27-13-11-26(12-14-27)22(28)4-3-15-30-19-8-5-17(24)6-9-19/h5-10,16H,2-4,11-15H2,1H3 |
| InChIKey | QFAVOYIECYOFOQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.07 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|