About 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol
5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol (PubChem CID 4127325) has the molecular formula C19H14F3N3OS
and a molecular weight of 389.40 g/mol. Its IUPAC name is 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol.
Molecular Properties
| Compound Name | 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol |
| PubChem CID | 4127325 |
| Molecular Formula | C19H14F3N3OS |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol |
| SMILES | OC1(C(F)(F)F)CC(c2ccccc2)=NN1c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C19H14F3N3OS/c20-19(21,22)18(26)11-15(13-7-3-1-4-8-13)24-25(18)17-23-16(12-27-17)14-9-5-2-6-10-14/h1-10,12,26H,11H2 |
| InChIKey | PWGGGQLSUQVPIX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol?
The IUPAC name of 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol (CID 4127325) is 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol.
What is the SMILES notation for 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol?
The canonical SMILES for 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol is OC1(C(F)(F)F)CC(c2ccccc2)=NN1c1nc(-c2ccccc2)cs1.
What is the InChIKey of 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol?
The InChIKey is PWGGGQLSUQVPIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3N3OS/c20-19(21,22)18(26)11-15(13-7-3-1-4-8-13)24-25(18)17-23-16(12-27-17)14-9-5-2-6-10-14/h1-10,12,26H,11H2.
What are the key properties of 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol?
5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol has a molecular weight of 389.40 g/mol, XLogP of 4.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol is sourced from PubChem (CID 4127325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).