C23H28O5 — CID 4127688
2-[(4,4-dimethyl-2,6-dioxocyclohexyl)-(3-hydroxyphenyl)methyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 4127688) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-2,6-dioxocyclohexyl)-(3-hydroxyphenyl)methyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[(4,4-dimethyl-2,6-dioxocyclohexyl)-(3-hydroxyphenyl)methyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 4127688 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-[(4,4-dimethyl-2,6-dioxocyclohexyl)-(3-hydroxyphenyl)methyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(C(c2cccc(O)c2)C2C(=O)CC(C)(C)CC2=O)C(=O)C1 |
| InChI | InChI=1S/C23H28O5/c1-22(2)9-15(25)20(16(26)10-22)19(13-6-5-7-14(24)8-13)21-17(27)11-23(3,4)12-18(21)28/h5-8,19-21,24H,9-12H2,1-4H3 |
| InChIKey | ZRPCZKZZGPSOOZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|