About 4-octoxy-N-phenylaniline
4-octoxy-N-phenylaniline (PubChem CID 4127793) has the molecular formula C20H27NO
and a molecular weight of 297.44 g/mol. Its IUPAC name is 4-octoxy-N-phenylaniline.
Molecular Properties
| Compound Name | 4-octoxy-N-phenylaniline |
| PubChem CID | 4127793 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 4-octoxy-N-phenylaniline |
| SMILES | CCCCCCCCOc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C20H27NO/c1-2-3-4-5-6-10-17-22-20-15-13-19(14-16-20)21-18-11-8-7-9-12-18/h7-9,11-16,21H,2-6,10,17H2,1H3 |
| InChIKey | KCVLQWYAQLRYBF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-octoxy-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-octoxy-N-phenylaniline?
The IUPAC name of 4-octoxy-N-phenylaniline (CID 4127793) is 4-octoxy-N-phenylaniline.
What is the SMILES notation for 4-octoxy-N-phenylaniline?
The canonical SMILES for 4-octoxy-N-phenylaniline is CCCCCCCCOc1ccc(Nc2ccccc2)cc1.
What is the InChIKey of 4-octoxy-N-phenylaniline?
The InChIKey is KCVLQWYAQLRYBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO/c1-2-3-4-5-6-10-17-22-20-15-13-19(14-16-20)21-18-11-8-7-9-12-18/h7-9,11-16,21H,2-6,10,17H2,1H3.
What are the key properties of 4-octoxy-N-phenylaniline?
4-octoxy-N-phenylaniline has a molecular weight of 297.44 g/mol, XLogP of 6.17, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-octoxy-N-phenylaniline is sourced from PubChem (CID 4127793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).