About 2-hydroxy-3,5,7-trimethylcyclohepta-2,4,6-trien-1-one
2-hydroxy-3,5,7-trimethylcyclohepta-2,4,6-trien-1-one (PubChem CID 4127804) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-hydroxy-3,5,7-trimethylcyclohepta-2,4,6-trien-1-one.
Analyze 2-hydroxy-3,5,7-trimethylcyclohepta-2,4,6-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,5,7-trimethylcyclohepta-2,4,6-trien-1-one?
The IUPAC name of 2-hydroxy-3,5,7-trimethylcyclohepta-2,4,6-trien-1-one (CID 4127804) is 2-hydroxy-3,5,7-trimethylcyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for 2-hydroxy-3,5,7-trimethylcyclohepta-2,4,6-trien-1-one?
The canonical SMILES for 2-hydroxy-3,5,7-trimethylcyclohepta-2,4,6-trien-1-one is Cc1cc(C)c(O)c(=O)c(C)c1.
What is the InChIKey of 2-hydroxy-3,5,7-trimethylcyclohepta-2,4,6-trien-1-one?
The InChIKey is LJUSIYDCCGZREV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-6-4-7(2)9(11)10(12)8(3)5-6/h4-5H,1-3H3,(H,11,12).
What are the key properties of 2-hydroxy-3,5,7-trimethylcyclohepta-2,4,6-trien-1-one?
2-hydroxy-3,5,7-trimethylcyclohepta-2,4,6-trien-1-one has a molecular weight of 164.20 g/mol, XLogP of 1.68, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,5,7-trimethylcyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 4127804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).