C25H21F2N3O3 — CID 41284915
N-(3-fluorophenyl)-2-[(4S)-3-[(4-fluorophenyl)methyl]-1-(3-methylphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 41284915) has the molecular formula C25H21F2N3O3 and a molecular weight of 449.46 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[(4S)-3-[(4-fluorophenyl)methyl]-1-(3-methylphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[(4S)-3-[(4-fluorophenyl)methyl]-1-(3-methylphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 41284915 |
| Molecular Formula | C25H21F2N3O3 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-(3-fluorophenyl)-2-[(4S)-3-[(4-fluorophenyl)methyl]-1-(3-methylphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | Cc1cccc(N2C(=O)[C@H](CC(=O)Nc3cccc(F)c3)N(Cc3ccc(F)cc3)C2=O)c1 |
| InChI | InChI=1S/C25H21F2N3O3/c1-16-4-2-7-21(12-16)30-24(32)22(14-23(31)28-20-6-3-5-19(27)13-20)29(25(30)33)15-17-8-10-18(26)11-9-17/h2-13,22H,14-15H2,1H3,(H,28,31)/t22-/m0/s1 |
| InChIKey | HMPGCPWXYLNTLI-QFIPXVFZSA-N |
| XLogP | 4.64 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|