C22H23F2N3O3S — CID 41285718
2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-[[4-(difluoromethoxy)phenyl]methyl]acetamide (PubChem CID 41285718) has the molecular formula C22H23F2N3O3S and a molecular weight of 447.51 g/mol. Its IUPAC name is 2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-[[4-(difluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-[[4-(difluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 41285718 |
| Molecular Formula | C22H23F2N3O3S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-[[4-(difluoromethoxy)phenyl]methyl]acetamide |
| SMILES | CCCCn1c(SCC(=O)NCc2ccc(OC(F)F)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H23F2N3O3S/c1-2-3-12-27-20(29)17-6-4-5-7-18(17)26-22(27)31-14-19(28)25-13-15-8-10-16(11-9-15)30-21(23)24/h4-11,21H,2-3,12-14H2,1H3,(H,25,28) |
| InChIKey | FIBYPDIJCKRDGV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |