C17H21N5O — CID 41286049
(6R)-1-(4,6-dimethylpyrimidin-2-yl)-6-methyl-3-(prop-2-enylamino)-6,7-dihydro-5H-indazol-4-one (PubChem CID 41286049) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is (6R)-1-(4,6-dimethylpyrimidin-2-yl)-6-methyl-3-(prop-2-enylamino)-6,7-dihydro-5H-indazol-4-one.
| Compound Name | (6R)-1-(4,6-dimethylpyrimidin-2-yl)-6-methyl-3-(prop-2-enylamino)-6,7-dihydro-5H-indazol-4-one |
|---|---|
| PubChem CID | 41286049 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (6R)-1-(4,6-dimethylpyrimidin-2-yl)-6-methyl-3-(prop-2-enylamino)-6,7-dihydro-5H-indazol-4-one |
| SMILES | C=CCNc1nn(-c2nc(C)cc(C)n2)c2c1C(=O)C[C@H](C)C2 |
| InChI | InChI=1S/C17H21N5O/c1-5-6-18-16-15-13(7-10(2)8-14(15)23)22(21-16)17-19-11(3)9-12(4)20-17/h5,9-10H,1,6-8H2,2-4H3,(H,18,21)/t10-/m1/s1 |
| InChIKey | QITDYENVKRWUSX-SNVBAGLBSA-N |
| XLogP | 2.64 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|