About 4-nitro-1,1-dioxothiolan-3-ol
4-nitro-1,1-dioxothiolan-3-ol (PubChem CID 4128839) has the molecular formula C4H7NO5S
and a molecular weight of 181.17 g/mol. Its IUPAC name is 4-nitro-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-nitro-1,1-dioxothiolan-3-ol |
| PubChem CID | 4128839 |
| Molecular Formula | C4H7NO5S |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 4-nitro-1,1-dioxothiolan-3-ol |
| SMILES | O=[N+]([O-])C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C4H7NO5S/c6-4-2-11(9,10)1-3(4)5(7)8/h3-4,6H,1-2H2 |
| InChIKey | ZJLQDEREPLWHPD-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-nitro-1,1-dioxothiolan-3-ol (CID 4128839) is 4-nitro-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-nitro-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-nitro-1,1-dioxothiolan-3-ol is O=[N+]([O-])C1CS(=O)(=O)CC1O.
What is the InChIKey of 4-nitro-1,1-dioxothiolan-3-ol?
The InChIKey is ZJLQDEREPLWHPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO5S/c6-4-2-11(9,10)1-3(4)5(7)8/h3-4,6H,1-2H2.
What are the key properties of 4-nitro-1,1-dioxothiolan-3-ol?
4-nitro-1,1-dioxothiolan-3-ol has a molecular weight of 181.17 g/mol, XLogP of -1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 4128839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).