C35H37NO4 — CID 41300137
[2-(4-methylphenyl)-2-oxoethyl] (2S)-2-[[4-(1-adamantyl)benzoyl]amino]-3-phenylpropanoate (PubChem CID 41300137) has the molecular formula C35H37NO4 and a molecular weight of 535.68 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] (2S)-2-[[4-(1-adamantyl)benzoyl]amino]-3-phenylpropanoate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] (2S)-2-[[4-(1-adamantyl)benzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 41300137 |
| Molecular Formula | C35H37NO4 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] (2S)-2-[[4-(1-adamantyl)benzoyl]amino]-3-phenylpropanoate |
| SMILES | Cc1ccc(C(=O)COC(=O)[C@H](Cc2ccccc2)NC(=O)c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)cc1 |
| InChI | InChI=1S/C35H37NO4/c1-23-7-9-28(10-8-23)32(37)22-40-34(39)31(18-24-5-3-2-4-6-24)36-33(38)29-11-13-30(14-12-29)35-19-25-15-26(20-35)17-27(16-25)21-35/h2-14,25-27,31H,15-22H2,1H3,(H,36,38)/t25?,26?,27?,31-,35?/m0/s1 |
| InChIKey | DCLVWTABLLLNKD-XCMLUUNSSA-N |
| XLogP | 6.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |