C17H18Cl2N2O5S — CID 41302643
(2S)-N-(3,5-dichlorophenyl)-2-[(3,4-dimethoxyphenyl)sulfonylamino]propanamide (PubChem CID 41302643) has the molecular formula C17H18Cl2N2O5S and a molecular weight of 433.31 g/mol. Its IUPAC name is (2S)-N-(3,5-dichlorophenyl)-2-[(3,4-dimethoxyphenyl)sulfonylamino]propanamide.
| Compound Name | (2S)-N-(3,5-dichlorophenyl)-2-[(3,4-dimethoxyphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 41302643 |
| Molecular Formula | C17H18Cl2N2O5S |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | (2S)-N-(3,5-dichlorophenyl)-2-[(3,4-dimethoxyphenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)C(=O)Nc2cc(Cl)cc(Cl)c2)cc1OC |
| InChI | InChI=1S/C17H18Cl2N2O5S/c1-10(17(22)20-13-7-11(18)6-12(19)8-13)21-27(23,24)14-4-5-15(25-2)16(9-14)26-3/h4-10,21H,1-3H3,(H,20,22)/t10-/m0/s1 |
| InChIKey | BNEOPQKQPCSGCN-JTQLQIEISA-N |
| XLogP | 3.32 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |