About 1,3,5-tris(chloromethyl)-2,4-dimethylbenzene
1,3,5-tris(chloromethyl)-2,4-dimethylbenzene (PubChem CID 4130329) has the molecular formula C11H13Cl3
and a molecular weight of 251.58 g/mol. Its IUPAC name is 1,3,5-tris(chloromethyl)-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1,3,5-tris(chloromethyl)-2,4-dimethylbenzene |
| PubChem CID | 4130329 |
| Molecular Formula | C11H13Cl3 |
| Molecular Weight | 251.58 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 1,3,5-tris(chloromethyl)-2,4-dimethylbenzene |
| SMILES | Cc1c(CCl)cc(CCl)c(C)c1CCl |
| InChI | InChI=1S/C11H13Cl3/c1-7-9(4-12)3-10(5-13)8(2)11(7)6-14/h3H,4-6H2,1-2H3 |
| InChIKey | ZWXFQYBSJMBRNK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3,5-tris(chloromethyl)-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-tris(chloromethyl)-2,4-dimethylbenzene?
The IUPAC name of 1,3,5-tris(chloromethyl)-2,4-dimethylbenzene (CID 4130329) is 1,3,5-tris(chloromethyl)-2,4-dimethylbenzene.
What is the SMILES notation for 1,3,5-tris(chloromethyl)-2,4-dimethylbenzene?
The canonical SMILES for 1,3,5-tris(chloromethyl)-2,4-dimethylbenzene is Cc1c(CCl)cc(CCl)c(C)c1CCl.
What is the InChIKey of 1,3,5-tris(chloromethyl)-2,4-dimethylbenzene?
The InChIKey is ZWXFQYBSJMBRNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl3/c1-7-9(4-12)3-10(5-13)8(2)11(7)6-14/h3H,4-6H2,1-2H3.
What are the key properties of 1,3,5-tris(chloromethyl)-2,4-dimethylbenzene?
1,3,5-tris(chloromethyl)-2,4-dimethylbenzene has a molecular weight of 251.58 g/mol, XLogP of 4.52, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-tris(chloromethyl)-2,4-dimethylbenzene is sourced from PubChem (CID 4130329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).