About [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate
[3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate (PubChem CID 4130562) has the molecular formula C24H19FN2O4S
and a molecular weight of 450.49 g/mol. Its IUPAC name is [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate.
Molecular Properties
| Compound Name | [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate |
| PubChem CID | 4130562 |
| Molecular Formula | C24H19FN2O4S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C)nn(-c3ccccc3)c2OC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C24H19FN2O4S/c1-16-12-14-19(15-13-16)32(29,30)22-17(2)26-27(18-8-4-3-5-9-18)23(22)31-24(28)20-10-6-7-11-21(20)25/h3-15H,1-2H3 |
| InChIKey | ULFGHQQBJSFWLN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate?
The IUPAC name of [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate (CID 4130562) is [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate.
What is the SMILES notation for [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate?
The canonical SMILES for [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate is Cc1ccc(S(=O)(=O)c2c(C)nn(-c3ccccc3)c2OC(=O)c2ccccc2F)cc1.
What is the InChIKey of [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate?
The InChIKey is ULFGHQQBJSFWLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19FN2O4S/c1-16-12-14-19(15-13-16)32(29,30)22-17(2)26-27(18-8-4-3-5-9-18)23(22)31-24(28)20-10-6-7-11-21(20)25/h3-15H,1-2H3.
What are the key properties of [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate?
[3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate has a molecular weight of 450.49 g/mol, XLogP of 4.68, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-fluorobenzoate is sourced from PubChem (CID 4130562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).