About 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide
2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide (PubChem CID 41306397) has the molecular formula C9H14N4OS
and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide.
Molecular Properties
| Compound Name | 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide |
| PubChem CID | 41306397 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide |
| SMILES | CCNC(=O)CSc1nncn1C1CC1 |
| InChI | InChI=1S/C9H14N4OS/c1-2-10-8(14)5-15-9-12-11-6-13(9)7-3-4-7/h6-7H,2-5H2,1H3,(H,10,14) |
| InChIKey | DBAHMTOFVBACQJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide?
The IUPAC name of 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide (CID 41306397) is 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide.
What is the SMILES notation for 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide?
The canonical SMILES for 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide is CCNC(=O)CSc1nncn1C1CC1.
What is the InChIKey of 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide?
The InChIKey is DBAHMTOFVBACQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4OS/c1-2-10-8(14)5-15-9-12-11-6-13(9)7-3-4-7/h6-7H,2-5H2,1H3,(H,10,14).
What are the key properties of 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide?
2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide has a molecular weight of 226.30 g/mol, XLogP of 0.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-ethylacetamide is sourced from PubChem (CID 41306397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).