About N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide
N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide (PubChem CID 41306445) has the molecular formula C18H20Cl2N2O
and a molecular weight of 351.28 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide.
Molecular Properties
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide |
| PubChem CID | 41306445 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide |
| SMILES | CN(CCCNC(=O)c1cccc(Cl)c1Cl)Cc1ccccc1 |
| InChI | InChI=1S/C18H20Cl2N2O/c1-22(13-14-7-3-2-4-8-14)12-6-11-21-18(23)15-9-5-10-16(19)17(15)20/h2-5,7-10H,6,11-13H2,1H3,(H,21,23) |
| InChIKey | NXKFVTNHLNZYJK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide?
The IUPAC name of N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide (CID 41306445) is N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide.
What is the SMILES notation for N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide?
The canonical SMILES for N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide is CN(CCCNC(=O)c1cccc(Cl)c1Cl)Cc1ccccc1.
What is the InChIKey of N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide?
The InChIKey is NXKFVTNHLNZYJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20Cl2N2O/c1-22(13-14-7-3-2-4-8-14)12-6-11-21-18(23)15-9-5-10-16(19)17(15)20/h2-5,7-10H,6,11-13H2,1H3,(H,21,23).
What are the key properties of N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide?
N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide has a molecular weight of 351.28 g/mol, XLogP of 4.25, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[benzyl(methyl)amino]propyl]-2,3-dichlorobenzamide is sourced from PubChem (CID 41306445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).