About methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate
methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate (PubChem CID 41306863) has the molecular formula C11H16N4O3S
and a molecular weight of 284.34 g/mol. Its IUPAC name is methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate |
| PubChem CID | 41306863 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)CSc1nncn1C1CC1 |
| InChI | InChI=1S/C11H16N4O3S/c1-18-10(17)4-5-12-9(16)6-19-11-14-13-7-15(11)8-2-3-8/h7-8H,2-6H2,1H3,(H,12,16) |
| InChIKey | YOEOWWPKTVWADO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate?
The IUPAC name of methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate (CID 41306863) is methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate.
What is the SMILES notation for methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate?
The canonical SMILES for methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate is COC(=O)CCNC(=O)CSc1nncn1C1CC1.
What is the InChIKey of methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate?
The InChIKey is YOEOWWPKTVWADO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O3S/c1-18-10(17)4-5-12-9(16)6-19-11-14-13-7-15(11)8-2-3-8/h7-8H,2-6H2,1H3,(H,12,16).
What are the key properties of methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate?
methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate has a molecular weight of 284.34 g/mol, XLogP of 0.38, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]propanoate is sourced from PubChem (CID 41306863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).