C20H29N3O4 — CID 41307290
[(2S,3S)-1-[4-(4-methoxybenzoyl)piperidin-1-yl]-3-methyl-1-oxopentan-2-yl]urea (PubChem CID 41307290) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is [(2S,3S)-1-[4-(4-methoxybenzoyl)piperidin-1-yl]-3-methyl-1-oxopentan-2-yl]urea.
| Compound Name | [(2S,3S)-1-[4-(4-methoxybenzoyl)piperidin-1-yl]-3-methyl-1-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 41307290 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | [(2S,3S)-1-[4-(4-methoxybenzoyl)piperidin-1-yl]-3-methyl-1-oxopentan-2-yl]urea |
| SMILES | CC[C@H](C)[C@H](NC(N)=O)C(=O)N1CCC(C(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C20H29N3O4/c1-4-13(2)17(22-20(21)26)19(25)23-11-9-15(10-12-23)18(24)14-5-7-16(27-3)8-6-14/h5-8,13,15,17H,4,9-12H2,1-3H3,(H3,21,22,26)/t13-,17-/m0/s1 |
| InChIKey | DPCYEGPKSKKYHB-GUYCJALGSA-N |
| XLogP | 2.20 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |