C19H18BrFN2O3 — CID 41307521
(5S)-3-[(4-bromo-2-fluorophenyl)methyl]-5-ethyl-5-(4-methoxyphenyl)imidazolidine-2,4-dione (PubChem CID 41307521) has the molecular formula C19H18BrFN2O3 and a molecular weight of 421.27 g/mol. Its IUPAC name is (5S)-3-[(4-bromo-2-fluorophenyl)methyl]-5-ethyl-5-(4-methoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(4-bromo-2-fluorophenyl)methyl]-5-ethyl-5-(4-methoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41307521 |
| Molecular Formula | C19H18BrFN2O3 |
| Molecular Weight | 421.27 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | (5S)-3-[(4-bromo-2-fluorophenyl)methyl]-5-ethyl-5-(4-methoxyphenyl)imidazolidine-2,4-dione |
| SMILES | CC[C@@]1(c2ccc(OC)cc2)NC(=O)N(Cc2ccc(Br)cc2F)C1=O |
| InChI | InChI=1S/C19H18BrFN2O3/c1-3-19(13-5-8-15(26-2)9-6-13)17(24)23(18(25)22-19)11-12-4-7-14(20)10-16(12)21/h4-10H,3,11H2,1-2H3,(H,22,25)/t19-/m0/s1 |
| InChIKey | BCZROYBBFAOIHU-IBGZPJMESA-N |
| XLogP | 3.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|